C7H11F3N2O4 — CID 122011441
3-[2-(trifluoromethoxy)ethylcarbamoylamino]propanoic acid (PubChem CID 122011441) has the molecular formula C7H11F3N2O4 and a molecular weight of 244.17 g/mol. Its IUPAC name is 3-[2-(trifluoromethoxy)ethylcarbamoylamino]propanoic acid.
| Compound Name | 3-[2-(trifluoromethoxy)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 122011441 |
| Molecular Formula | C7H11F3N2O4 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-[2-(trifluoromethoxy)ethylcarbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCCOC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O4/c8-7(9,10)16-4-3-12-6(15)11-2-1-5(13)14/h1-4H2,(H,13,14)(H2,11,12,15) |
| InChIKey | ULSDBOXGKCLMBZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|