C8H13F3N2O4 — CID 122011442
4-[2-(trifluoromethoxy)ethylcarbamoylamino]butanoic acid (PubChem CID 122011442) has the molecular formula C8H13F3N2O4 and a molecular weight of 258.20 g/mol. Its IUPAC name is 4-[2-(trifluoromethoxy)ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[2-(trifluoromethoxy)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122011442 |
| Molecular Formula | C8H13F3N2O4 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 4-[2-(trifluoromethoxy)ethylcarbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCCOC(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O4/c9-8(10,11)17-5-4-13-7(16)12-3-1-2-6(14)15/h1-5H2,(H,14,15)(H2,12,13,16) |
| InChIKey | UTVIEYNJTOGLCH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|