C7H10F4N2O3 — CID 106295060
3-(2,2,3,3-tetrafluoropropylcarbamoylamino)propanoic acid (PubChem CID 106295060) has the molecular formula C7H10F4N2O3 and a molecular weight of 246.16 g/mol. Its IUPAC name is 3-(2,2,3,3-tetrafluoropropylcarbamoylamino)propanoic acid.
| Compound Name | 3-(2,2,3,3-tetrafluoropropylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 106295060 |
| Molecular Formula | C7H10F4N2O3 |
| Molecular Weight | 246.16 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(2,2,3,3-tetrafluoropropylcarbamoylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H10F4N2O3/c8-5(9)7(10,11)3-13-6(16)12-2-1-4(14)15/h5H,1-3H2,(H,14,15)(H2,12,13,16) |
| InChIKey | VTUUBVRJYLTELT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|