C10H14F4N2O3 — CID 106294879
3-[cyclopropyl(2,2,3,3-tetrafluoropropylcarbamoyl)amino]propanoic acid (PubChem CID 106294879) has the molecular formula C10H14F4N2O3 and a molecular weight of 286.22 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,3,3-tetrafluoropropylcarbamoyl)amino]propanoic acid.
| Compound Name | 3-[cyclopropyl(2,2,3,3-tetrafluoropropylcarbamoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 106294879 |
| Molecular Formula | C10H14F4N2O3 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 3-[cyclopropyl(2,2,3,3-tetrafluoropropylcarbamoyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(C(=O)NCC(F)(F)C(F)F)C1CC1 |
| InChI | InChI=1S/C10H14F4N2O3/c11-8(12)10(13,14)5-15-9(19)16(6-1-2-6)4-3-7(17)18/h6,8H,1-5H2,(H,15,19)(H,17,18) |
| InChIKey | DSFFMCMLLJWCCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|