C8H11F4N3O4 — CID 114169808
2-[(2-amino-2-oxoethyl)-(2,2,3,3-tetrafluoropropylcarbamoyl)amino]acetic acid (PubChem CID 114169808) has the molecular formula C8H11F4N3O4 and a molecular weight of 289.19 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(2,2,3,3-tetrafluoropropylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(2,2,3,3-tetrafluoropropylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 114169808 |
| Molecular Formula | C8H11F4N3O4 |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(2,2,3,3-tetrafluoropropylcarbamoyl)amino]acetic acid |
| SMILES | NC(=O)CN(CC(=O)O)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H11F4N3O4/c9-6(10)8(11,12)3-14-7(19)15(1-4(13)16)2-5(17)18/h6H,1-3H2,(H2,13,16)(H,14,19)(H,17,18) |
| InChIKey | HUDYRNFMPIQSGS-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|