C10H19N3O4 — CID 107437318
2-[(2-amino-2-oxoethyl)-(pentylcarbamoyl)amino]acetic acid (PubChem CID 107437318) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(pentylcarbamoyl)amino]acetic acid.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(pentylcarbamoyl)amino]acetic acid |
|---|---|
| PubChem CID | 107437318 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(pentylcarbamoyl)amino]acetic acid |
| SMILES | CCCCCNC(=O)N(CC(N)=O)CC(=O)O |
| InChI | InChI=1S/C10H19N3O4/c1-2-3-4-5-12-10(17)13(6-8(11)14)7-9(15)16/h2-7H2,1H3,(H2,11,14)(H,12,17)(H,15,16) |
| InChIKey | DXEFJUYVLWOWLN-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|