C10H17F3N2O3 — CID 79258372
2-[pentylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79258372) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-[pentylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[pentylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79258372 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-[pentylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCCCCNC(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-2-3-4-5-14-9(18)15(6-8(16)17)7-10(11,12)13/h2-7H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | IYCAPFKICBAOBD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|