C10H17F3N2O5 — CID 79266737
2-[2-(2-methoxyethoxy)ethylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79266737) has the molecular formula C10H17F3N2O5 and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[2-(2-methoxyethoxy)ethylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79266737 |
| Molecular Formula | C10H17F3N2O5 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | COCCOCCNC(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O5/c1-19-4-5-20-3-2-14-9(18)15(6-8(16)17)7-10(11,12)13/h2-7H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | BJPSWOLGSNQHLL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|