C9H15F3N2O5 — CID 107481876
2-[2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]amino]ethoxy]acetic acid (PubChem CID 107481876) has the molecular formula C9H15F3N2O5 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-[2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]amino]ethoxy]acetic acid.
| Compound Name | 2-[2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]amino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 107481876 |
| Molecular Formula | C9H15F3N2O5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-[2-[[2-hydroxyethyl(2,2,2-trifluoroethyl)carbamoyl]amino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNC(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O5/c10-9(11,12)6-14(2-3-15)8(18)13-1-4-19-5-7(16)17/h15H,1-6H2,(H,13,18)(H,16,17) |
| InChIKey | TUORRYVWWVHKQO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|