C10H18F3N3O3 — CID 79265962
2-[3-(ethylamino)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79265962) has the molecular formula C10H18F3N3O3 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[3-(ethylamino)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[3-(ethylamino)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 79265962 |
| Molecular Formula | C10H18F3N3O3 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-[3-(ethylamino)propylcarbamoyl-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCNCCCNC(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O3/c1-2-14-4-3-5-15-9(19)16(6-8(17)18)7-10(11,12)13/h14H,2-7H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | BIGMVTGKRSPVPJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|