C13H23F3N2O3 — CID 103995571
2-[2-ethylhexylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 103995571) has the molecular formula C13H23F3N2O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-[2-ethylhexylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[2-ethylhexylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 103995571 |
| Molecular Formula | C13H23F3N2O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 2-[2-ethylhexylcarbamoyl(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | CCCCC(CC)CNC(=O)N(CC(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O3/c1-3-5-6-10(4-2)7-17-12(21)18(8-11(19)20)9-13(14,15)16/h10H,3-9H2,1-2H3,(H,17,21)(H,19,20) |
| InChIKey | PFIOAMMKMRNZED-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |