About N-(2-ethylhexyl)acetamide;fluoromethane
N-(2-ethylhexyl)acetamide;fluoromethane (PubChem CID 145149425) has the molecular formula C11H24FNO
and a molecular weight of 205.32 g/mol. Its IUPAC name is N-(2-ethylhexyl)acetamide;fluoromethane.
Molecular Properties
| Compound Name | N-(2-ethylhexyl)acetamide;fluoromethane |
| PubChem CID | 145149425 |
| Molecular Formula | C11H24FNO |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N-(2-ethylhexyl)acetamide;fluoromethane |
| SMILES | CCCCC(CC)CNC(C)=O.CF |
| InChI | InChI=1S/C10H21NO.CH3F/c1-4-6-7-10(5-2)8-11-9(3)12;1-2/h10H,4-8H2,1-3H3,(H,11,12);1H3 |
| InChIKey | IQMRTUVHUIXDPB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-ethylhexyl)acetamide;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethylhexyl)acetamide;fluoromethane?
The IUPAC name of N-(2-ethylhexyl)acetamide;fluoromethane (CID 145149425) is N-(2-ethylhexyl)acetamide;fluoromethane.
What is the SMILES notation for N-(2-ethylhexyl)acetamide;fluoromethane?
The canonical SMILES for N-(2-ethylhexyl)acetamide;fluoromethane is CCCCC(CC)CNC(C)=O.CF.
What is the InChIKey of N-(2-ethylhexyl)acetamide;fluoromethane?
The InChIKey is IQMRTUVHUIXDPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.CH3F/c1-4-6-7-10(5-2)8-11-9(3)12;1-2/h10H,4-8H2,1-3H3,(H,11,12);1H3.
What are the key properties of N-(2-ethylhexyl)acetamide;fluoromethane?
N-(2-ethylhexyl)acetamide;fluoromethane has a molecular weight of 205.32 g/mol, XLogP of 2.92, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethylhexyl)acetamide;fluoromethane is sourced from PubChem (CID 145149425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).