C12H23NO — CID 23335626
(E)-N-(2-ethylhexyl)but-2-enamide (PubChem CID 23335626) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E)-N-(2-ethylhexyl)but-2-enamide.
| Compound Name | (E)-N-(2-ethylhexyl)but-2-enamide |
|---|---|
| PubChem CID | 23335626 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E)-N-(2-ethylhexyl)but-2-enamide |
| SMILES | C/C=C/C(=O)NCC(CC)CCCC |
| InChI | InChI=1S/C12H23NO/c1-4-7-9-11(6-3)10-13-12(14)8-5-2/h5,8,11H,4,6-7,9-10H2,1-3H3,(H,13,14)/b8-5+ |
| InChIKey | DIYAOKIMBPJKQL-VMPITWQZSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|