C15H23NO2 — CID 6382996
(E)-N-(2-ethylhexyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 6382996) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (E)-N-(2-ethylhexyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-ethylhexyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 6382996 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (E)-N-(2-ethylhexyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCCCC(CC)CNC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C15H23NO2/c1-3-5-7-13(4-2)12-16-15(17)10-9-14-8-6-11-18-14/h6,8-11,13H,3-5,7,12H2,1-2H3,(H,16,17)/b10-9+ |
| InChIKey | BMZJQCBIEOOSPQ-MDZDMXLPSA-N |
| XLogP | 3.63 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|