C13H19NO4S — CID 75407332
(E)-N-(2-ethylbutylsulfonyl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 75407332) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is (E)-N-(2-ethylbutylsulfonyl)-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-ethylbutylsulfonyl)-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75407332 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (E)-N-(2-ethylbutylsulfonyl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCC(CC)CS(=O)(=O)NC(=O)/C=C/c1ccco1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-11(4-2)10-19(16,17)14-13(15)8-7-12-6-5-9-18-12/h5-9,11H,3-4,10H2,1-2H3,(H,14,15)/b8-7+ |
| InChIKey | OFXXMCKLLGZGNT-BQYQJAHWSA-N |
| XLogP | 2.17 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|