About calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride
calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride (PubChem CID 173102099) has the molecular formula C12H25CaNO2
and a molecular weight of 255.41 g/mol. Its IUPAC name is calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride.
Molecular Properties
| Compound Name | calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride |
| PubChem CID | 173102099 |
| Molecular Formula | C12H25CaNO2 |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride |
| SMILES | CCCCC(CC)CNC(=O)CC(C)=O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C12H23NO2.Ca.2H/c1-4-6-7-11(5-2)9-13-12(15)8-10(3)14;;;/h11H,4-9H2,1-3H3,(H,13,15);;;/q;+2;2*-1 |
| InChIKey | GOFGCYRNUWXUGJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride?
The IUPAC name of calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride (CID 173102099) is calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride.
What is the SMILES notation for calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride?
The canonical SMILES for calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride is CCCCC(CC)CNC(=O)CC(C)=O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride?
The InChIKey is GOFGCYRNUWXUGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2.Ca.2H/c1-4-6-7-11(5-2)9-13-12(15)8-10(3)14;;;/h11H,4-9H2,1-3H3,(H,13,15);;;/q;+2;2*-1.
What are the key properties of calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride?
calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride has a molecular weight of 255.41 g/mol, XLogP of 2.14, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;N-(2-ethylhexyl)-3-oxobutanamide;hydride is sourced from PubChem (CID 173102099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).