C15H29NO3 — CID 55155767
5-(2-ethylhexylamino)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 55155767) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 5-(2-ethylhexylamino)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(2-ethylhexylamino)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 55155767 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 5-(2-ethylhexylamino)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCCCC(CC)CNC(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C15H29NO3/c1-5-7-8-12(6-2)11-16-13(17)9-15(3,4)10-14(18)19/h12H,5-11H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | FLKDMLUDHBKKFS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |