C16H31NO6 — CID 23615613
butanedioic acid;N-(2-ethylhexyl)-3-hydroxybutanamide (PubChem CID 23615613) has the molecular formula C16H31NO6 and a molecular weight of 333.43 g/mol. Its IUPAC name is butanedioic acid;N-(2-ethylhexyl)-3-hydroxybutanamide.
| Compound Name | butanedioic acid;N-(2-ethylhexyl)-3-hydroxybutanamide |
|---|---|
| PubChem CID | 23615613 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | butanedioic acid;N-(2-ethylhexyl)-3-hydroxybutanamide |
| SMILES | CCCCC(CC)CNC(=O)CC(C)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C12H25NO2.C4H6O4/c1-4-6-7-11(5-2)9-13-12(15)8-10(3)14;5-3(6)1-2-4(7)8/h10-11,14H,4-9H2,1-3H3,(H,13,15);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | VEUPQSBURJGBGK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |