C15H27NO5S — CID 101147657
2-[3-(2-ethylhexylamino)-3-oxopropyl]sulfanylbutanedioic acid (PubChem CID 101147657) has the molecular formula C15H27NO5S and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-[3-(2-ethylhexylamino)-3-oxopropyl]sulfanylbutanedioic acid.
| Compound Name | 2-[3-(2-ethylhexylamino)-3-oxopropyl]sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 101147657 |
| Molecular Formula | C15H27NO5S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-[3-(2-ethylhexylamino)-3-oxopropyl]sulfanylbutanedioic acid |
| SMILES | CCCCC(CC)CNC(=O)CCSC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27NO5S/c1-3-5-6-11(4-2)10-16-13(17)7-8-22-12(15(20)21)9-14(18)19/h11-12H,3-10H2,1-2H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | AERYMTLVHIKCPE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |