About fluoromethane;N-[(2R)-2-methylhexyl]acetamide
fluoromethane;N-[(2R)-2-methylhexyl]acetamide (PubChem CID 145149419) has the molecular formula C10H22FNO
and a molecular weight of 191.29 g/mol. Its IUPAC name is fluoromethane;N-[(2R)-2-methylhexyl]acetamide.
Molecular Properties
| Compound Name | fluoromethane;N-[(2R)-2-methylhexyl]acetamide |
| PubChem CID | 145149419 |
| Molecular Formula | C10H22FNO |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | fluoromethane;N-[(2R)-2-methylhexyl]acetamide |
| SMILES | CCCC[C@@H](C)CNC(C)=O.CF |
| InChI | InChI=1S/C9H19NO.CH3F/c1-4-5-6-8(2)7-10-9(3)11;1-2/h8H,4-7H2,1-3H3,(H,10,11);1H3/t8-;/m1./s1 |
| InChIKey | GYNJHOURGBWCCJ-DDWIOCJRSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze fluoromethane;N-[(2R)-2-methylhexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;N-[(2R)-2-methylhexyl]acetamide?
The IUPAC name of fluoromethane;N-[(2R)-2-methylhexyl]acetamide (CID 145149419) is fluoromethane;N-[(2R)-2-methylhexyl]acetamide.
What is the SMILES notation for fluoromethane;N-[(2R)-2-methylhexyl]acetamide?
The canonical SMILES for fluoromethane;N-[(2R)-2-methylhexyl]acetamide is CCCC[C@@H](C)CNC(C)=O.CF.
What is the InChIKey of fluoromethane;N-[(2R)-2-methylhexyl]acetamide?
The InChIKey is GYNJHOURGBWCCJ-DDWIOCJRSA-N. The full InChI is InChI=1S/C9H19NO.CH3F/c1-4-5-6-8(2)7-10-9(3)11;1-2/h8H,4-7H2,1-3H3,(H,10,11);1H3/t8-;/m1./s1.
What are the key properties of fluoromethane;N-[(2R)-2-methylhexyl]acetamide?
fluoromethane;N-[(2R)-2-methylhexyl]acetamide has a molecular weight of 191.29 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;N-[(2R)-2-methylhexyl]acetamide is sourced from PubChem (CID 145149419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).