C8H18N2O3 — CID 115580140
3-[2-(2-methoxyethoxy)ethyl]-1,1-dimethylurea (PubChem CID 115580140) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(2-methoxyethoxy)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 115580140 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethyl]-1,1-dimethylurea |
| SMILES | COCCOCCNC(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-10(2)8(11)9-4-5-13-7-6-12-3/h4-7H2,1-3H3,(H,9,11) |
| InChIKey | LYRYEZVLXZNXKA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|