C8H17NO3S — CID 107027119
N-[2-(2-methoxyethoxy)ethyl]-3-sulfanylpropanamide (PubChem CID 107027119) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107027119 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-3-sulfanylpropanamide |
| SMILES | COCCOCCNC(=O)CCS |
| InChI | InChI=1S/C8H17NO3S/c1-11-5-6-12-4-3-9-8(10)2-7-13/h13H,2-7H2,1H3,(H,9,10) |
| InChIKey | PTGCODCOYHDVPF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|