C10H19NO4S — CID 88982905
N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]-3-sulfanylpropanamide (PubChem CID 88982905) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]-3-sulfanylpropanamide.
| Compound Name | N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 88982905 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-[2-[2-(3-oxopropoxy)ethoxy]ethyl]-3-sulfanylpropanamide |
| SMILES | O=CCCOCCOCCNC(=O)CCS |
| InChI | InChI=1S/C10H19NO4S/c12-4-1-5-14-7-8-15-6-3-11-10(13)2-9-16/h4,16H,1-3,5-9H2,(H,11,13) |
| InChIKey | YLRBZAZKLUAHTO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|