C14H28N2O5S — CID 126759423
N-[3-[2-[2-(3-formamidopropoxy)ethoxy]ethoxy]propyl]-3-sulfanylpropanamide (PubChem CID 126759423) has the molecular formula C14H28N2O5S and a molecular weight of 336.45 g/mol. Its IUPAC name is N-[3-[2-[2-(3-formamidopropoxy)ethoxy]ethoxy]propyl]-3-sulfanylpropanamide.
| Compound Name | N-[3-[2-[2-(3-formamidopropoxy)ethoxy]ethoxy]propyl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 126759423 |
| Molecular Formula | C14H28N2O5S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[3-[2-[2-(3-formamidopropoxy)ethoxy]ethoxy]propyl]-3-sulfanylpropanamide |
| SMILES | O=CNCCCOCCOCCOCCCNC(=O)CCS |
| InChI | InChI=1S/C14H28N2O5S/c17-13-15-4-1-6-19-8-10-21-11-9-20-7-2-5-16-14(18)3-12-22/h13,22H,1-12H2,(H,15,17)(H,16,18) |
| InChIKey | GRVWRUPOMVHULT-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|