C14H26N2O6 — CID 135199713
3-[2-[2-(6-formamidohexanoylamino)ethoxy]ethoxy]propanoic acid (PubChem CID 135199713) has the molecular formula C14H26N2O6 and a molecular weight of 318.37 g/mol. Its IUPAC name is 3-[2-[2-(6-formamidohexanoylamino)ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-(6-formamidohexanoylamino)ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 135199713 |
| Molecular Formula | C14H26N2O6 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3-[2-[2-(6-formamidohexanoylamino)ethoxy]ethoxy]propanoic acid |
| SMILES | O=CNCCCCCC(=O)NCCOCCOCCC(=O)O |
| InChI | InChI=1S/C14H26N2O6/c17-12-15-6-3-1-2-4-13(18)16-7-9-22-11-10-21-8-5-14(19)20/h12H,1-11H2,(H,15,17)(H,16,18)(H,19,20) |
| InChIKey | BSWFZHALOWAGAD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|