C22H38N2O10 — CID 146387622
3-[2-[2-[2-[2-[6-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 146387622) has the molecular formula C22H38N2O10 and a molecular weight of 490.55 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[6-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[6-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 146387622 |
| Molecular Formula | C22H38N2O10 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 3-[2-[2-[2-[2-[6-[[(Z)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | COC(=O)/C=C\C(=O)NCCCCCC(=O)NCCOCCOCCOCCOCCC(=O)O |
| InChI | InChI=1S/C22H38N2O10/c1-30-22(29)7-6-20(26)23-9-4-2-3-5-19(25)24-10-12-32-14-16-34-18-17-33-15-13-31-11-8-21(27)28/h6-7H,2-5,8-18H2,1H3,(H,23,26)(H,24,25)(H,27,28)/b7-6- |
| InChIKey | VTPVIIWDHQCROA-SREVYHEPSA-N |
| XLogP | 0.05 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|