C24H42N4O6 — CID 166503839
6-(prop-2-enoylamino)-N-[2-[2-[2-[6-(prop-2-enoylamino)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 166503839) has the molecular formula C24H42N4O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is 6-(prop-2-enoylamino)-N-[2-[2-[2-[6-(prop-2-enoylamino)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 6-(prop-2-enoylamino)-N-[2-[2-[2-[6-(prop-2-enoylamino)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 166503839 |
| Molecular Formula | C24H42N4O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 6-(prop-2-enoylamino)-N-[2-[2-[2-[6-(prop-2-enoylamino)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | C=CC(=O)NCCCCCC(=O)NCCOCCOCCNC(=O)CCCCCNC(=O)C=C |
| InChI | InChI=1S/C24H42N4O6/c1-3-21(29)25-13-9-5-7-11-23(31)27-15-17-33-19-20-34-18-16-28-24(32)12-8-6-10-14-26-22(30)4-2/h3-4H,1-2,5-20H2,(H,25,29)(H,26,30)(H,27,31)(H,28,32) |
| InChIKey | RCLCXOHWQKEYEB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|