C15H30N2O6 — CID 172914434
N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide (PubChem CID 172914434) has the molecular formula C15H30N2O6 and a molecular weight of 334.41 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide.
| Compound Name | N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 172914434 |
| Molecular Formula | C15H30N2O6 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCOCCOCCOCCOCCOCCN |
| InChI | InChI=1S/C15H30N2O6/c1-2-15(18)17-4-6-20-8-10-22-12-14-23-13-11-21-9-7-19-5-3-16/h2H,1,3-14,16H2,(H,17,18) |
| InChIKey | GSMNZIZYZPGACZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 101.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|