C8H14NO5S- — CID 154597585
3-[2-(prop-2-enoylamino)ethoxy]propane-1-sulfonate (PubChem CID 154597585) has the molecular formula C8H14NO5S- and a molecular weight of 236.27 g/mol. Its IUPAC name is 3-[2-(prop-2-enoylamino)ethoxy]propane-1-sulfonate.
| Compound Name | 3-[2-(prop-2-enoylamino)ethoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 154597585 |
| Molecular Formula | C8H14NO5S- |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-[2-(prop-2-enoylamino)ethoxy]propane-1-sulfonate |
| SMILES | C=CC(=O)NCCOCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H15NO5S/c1-2-8(10)9-4-6-14-5-3-7-15(11,12)13/h2H,1,3-7H2,(H,9,10)(H,11,12,13)/p-1 |
| InChIKey | YFELCAIKQZHKSM-UHFFFAOYSA-M |
| XLogP | -0.76 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|