C8H15NO3 — CID 106305722
N-[3-(2-hydroxyethoxy)propyl]prop-2-enamide (PubChem CID 106305722) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-[3-(2-hydroxyethoxy)propyl]prop-2-enamide.
| Compound Name | N-[3-(2-hydroxyethoxy)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 106305722 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-[3-(2-hydroxyethoxy)propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCOCCO |
| InChI | InChI=1S/C8H15NO3/c1-2-8(11)9-4-3-6-12-7-5-10/h2,10H,1,3-7H2,(H,9,11) |
| InChIKey | GJTLVWHDESBBIU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|