C22H37N3O6 — CID 144750197
N-[3-[3,4-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide (PubChem CID 144750197) has the molecular formula C22H37N3O6 and a molecular weight of 439.55 g/mol. Its IUPAC name is N-[3-[3,4-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide.
| Compound Name | N-[3-[3,4-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 144750197 |
| Molecular Formula | C22H37N3O6 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | N-[3-[3,4-bis[3-(prop-2-enoylamino)propoxy]butoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCOCCC(COCCCNC(=O)C=C)OCCCNC(=O)C=C |
| InChI | InChI=1S/C22H37N3O6/c1-4-20(26)23-11-7-14-29-17-10-19(31-16-9-13-25-22(28)6-3)18-30-15-8-12-24-21(27)5-2/h4-6,19H,1-3,7-18H2,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | JDLPVNUMVNMHGL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|