C14H25ClN2O4 — CID 145023766
N-[3-[4-chloro-1-(3-formamidopropoxy)butan-2-yl]oxypropyl]prop-2-enamide (PubChem CID 145023766) has the molecular formula C14H25ClN2O4 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-[3-[4-chloro-1-(3-formamidopropoxy)butan-2-yl]oxypropyl]prop-2-enamide.
| Compound Name | N-[3-[4-chloro-1-(3-formamidopropoxy)butan-2-yl]oxypropyl]prop-2-enamide |
|---|---|
| PubChem CID | 145023766 |
| Molecular Formula | C14H25ClN2O4 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N-[3-[4-chloro-1-(3-formamidopropoxy)butan-2-yl]oxypropyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCOC(CCCl)COCCCNC=O |
| InChI | InChI=1S/C14H25ClN2O4/c1-2-14(19)17-8-4-10-21-13(5-6-15)11-20-9-3-7-16-12-18/h2,12-13H,1,3-11H2,(H,16,18)(H,17,19) |
| InChIKey | AILFSQIPTFOHSU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|