C26H40N4O7 — CID 139546832
N-[4-oxo-6-(prop-2-enoylamino)-7-[3-(prop-2-enoylamino)propoxy]-6-[3-(prop-2-enoylamino)propoxymethyl]heptyl]prop-2-enamide (PubChem CID 139546832) has the molecular formula C26H40N4O7 and a molecular weight of 520.63 g/mol. Its IUPAC name is N-[4-oxo-6-(prop-2-enoylamino)-7-[3-(prop-2-enoylamino)propoxy]-6-[3-(prop-2-enoylamino)propoxymethyl]heptyl]prop-2-enamide.
| Compound Name | N-[4-oxo-6-(prop-2-enoylamino)-7-[3-(prop-2-enoylamino)propoxy]-6-[3-(prop-2-enoylamino)propoxymethyl]heptyl]prop-2-enamide |
|---|---|
| PubChem CID | 139546832 |
| Molecular Formula | C26H40N4O7 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.29 |
| IUPAC Name | N-[4-oxo-6-(prop-2-enoylamino)-7-[3-(prop-2-enoylamino)propoxy]-6-[3-(prop-2-enoylamino)propoxymethyl]heptyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCOCC(COCCCNC(=O)C=C)(CC(=O)CCCNC(=O)C=C)NC(=O)C=C |
| InChI | InChI=1S/C26H40N4O7/c1-5-22(32)27-13-9-12-21(31)18-26(30-25(35)8-4,19-36-16-10-14-28-23(33)6-2)20-37-17-11-15-29-24(34)7-3/h5-8H,1-4,9-20H2,(H,27,32)(H,28,33)(H,29,34)(H,30,35) |
| InChIKey | HRUBUPZHVVUMSF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 151.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|