C23H40N4O6 — CID 130306231
N-[3-[2-[3-(methylamino)propoxymethyl]-2-(prop-2-enoylamino)-3-[3-(prop-2-enoylamino)propoxy]propoxy]propyl]prop-2-enamide (PubChem CID 130306231) has the molecular formula C23H40N4O6 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[3-[2-[3-(methylamino)propoxymethyl]-2-(prop-2-enoylamino)-3-[3-(prop-2-enoylamino)propoxy]propoxy]propyl]prop-2-enamide.
| Compound Name | N-[3-[2-[3-(methylamino)propoxymethyl]-2-(prop-2-enoylamino)-3-[3-(prop-2-enoylamino)propoxy]propoxy]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 130306231 |
| Molecular Formula | C23H40N4O6 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | N-[3-[2-[3-(methylamino)propoxymethyl]-2-(prop-2-enoylamino)-3-[3-(prop-2-enoylamino)propoxy]propoxy]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCCOCC(COCCCNC)(COCCCNC(=O)C=C)NC(=O)C=C |
| InChI | InChI=1S/C23H40N4O6/c1-5-20(28)25-12-9-15-32-18-23(27-22(30)7-3,17-31-14-8-11-24-4)19-33-16-10-13-26-21(29)6-2/h5-7,24H,1-3,8-19H2,4H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | XRGJUUXFDUTDJY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|