C13H27N2O4+ — CID 58085082
2-hydroxyethyl-dimethyl-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethyl]azanium (PubChem CID 58085082) has the molecular formula C13H27N2O4+ and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-hydroxyethyl-dimethyl-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethyl]azanium.
| Compound Name | 2-hydroxyethyl-dimethyl-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 58085082 |
| Molecular Formula | C13H27N2O4+ |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 2-hydroxyethyl-dimethyl-[2-[2-[2-(prop-2-enoylamino)ethoxy]ethoxy]ethyl]azanium |
| SMILES | C=CC(=O)NCCOCCOCC[N+](C)(C)CCO |
| InChI | InChI=1S/C13H26N2O4/c1-4-13(17)14-5-9-18-11-12-19-10-7-15(2,3)6-8-16/h4,16H,1,5-12H2,2-3H3/p+1 |
| InChIKey | DDEVSVIFIMDJTN-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|