C13H28N2O6P+ — CID 163751657
2-[hydroxy(methyl)phosphoryl]oxyethyl-dimethyl-[2-[2-(prop-2-enoxycarbonylamino)ethoxy]ethyl]azanium (PubChem CID 163751657) has the molecular formula C13H28N2O6P+ and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[hydroxy(methyl)phosphoryl]oxyethyl-dimethyl-[2-[2-(prop-2-enoxycarbonylamino)ethoxy]ethyl]azanium.
| Compound Name | 2-[hydroxy(methyl)phosphoryl]oxyethyl-dimethyl-[2-[2-(prop-2-enoxycarbonylamino)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 163751657 |
| Molecular Formula | C13H28N2O6P+ |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-[hydroxy(methyl)phosphoryl]oxyethyl-dimethyl-[2-[2-(prop-2-enoxycarbonylamino)ethoxy]ethyl]azanium |
| SMILES | C=CCOC(=O)NCCOCC[N+](C)(C)CCOP(C)(=O)O |
| InChI | InChI=1S/C13H27N2O6P/c1-5-9-20-13(16)14-6-10-19-11-7-15(2,3)8-12-21-22(4,17)18/h5H,1,6-12H2,2-4H3,(H-,14,16,17,18)/p+1 |
| InChIKey | LQMPKAWSFVXAHI-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|