C23H46N3O13P — CID 59728788
4-[4-[1-[2-(2-methoxyethoxy)ethylcarbamoyloxy]-3-(2-methoxyethoxymethylcarbamoyloxy)propan-2-yl]oxybutanoylamino]butoxy-methylphosphinic acid (PubChem CID 59728788) has the molecular formula C23H46N3O13P and a molecular weight of 603.60 g/mol. Its IUPAC name is 4-[4-[1-[2-(2-methoxyethoxy)ethylcarbamoyloxy]-3-(2-methoxyethoxymethylcarbamoyloxy)propan-2-yl]oxybutanoylamino]butoxy-methylphosphinic acid.
| Compound Name | 4-[4-[1-[2-(2-methoxyethoxy)ethylcarbamoyloxy]-3-(2-methoxyethoxymethylcarbamoyloxy)propan-2-yl]oxybutanoylamino]butoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 59728788 |
| Molecular Formula | C23H46N3O13P |
| Molecular Weight | 603.60 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 4-[4-[1-[2-(2-methoxyethoxy)ethylcarbamoyloxy]-3-(2-methoxyethoxymethylcarbamoyloxy)propan-2-yl]oxybutanoylamino]butoxy-methylphosphinic acid |
| SMILES | COCCOCCNC(=O)OCC(COC(=O)NCOCCOC)OCCCC(=O)NCCCCOP(C)(=O)O |
| InChI | InChI=1S/C23H46N3O13P/c1-32-13-15-34-12-9-25-22(28)37-17-20(18-38-23(29)26-19-35-16-14-33-2)36-10-6-7-21(27)24-8-4-5-11-39-40(3,30)31/h20H,4-19H2,1-3H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | CVOQJXXFJJYEEI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 198.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.60 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|