C30H49N3O13 — CID 58242283
[2-[7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxoheptoxy]-3-[2-(2-methoxyethoxy)ethylcarbamoyloxy]propyl] 4-(2-methoxyethoxy)butanoate (PubChem CID 58242283) has the molecular formula C30H49N3O13 and a molecular weight of 659.73 g/mol. Its IUPAC name is [2-[7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxoheptoxy]-3-[2-(2-methoxyethoxy)ethylcarbamoyloxy]propyl] 4-(2-methoxyethoxy)butanoate.
| Compound Name | [2-[7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxoheptoxy]-3-[2-(2-methoxyethoxy)ethylcarbamoyloxy]propyl] 4-(2-methoxyethoxy)butanoate |
|---|---|
| PubChem CID | 58242283 |
| Molecular Formula | C30H49N3O13 |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 659.33 |
| IUPAC Name | [2-[7-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-4-oxoheptoxy]-3-[2-(2-methoxyethoxy)ethylcarbamoyloxy]propyl] 4-(2-methoxyethoxy)butanoate |
| SMILES | COCCOCCCC(=O)OCC(COC(=O)NCCOCCOC)OCCCC(=O)CCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C30H49N3O13/c1-40-18-20-42-15-5-8-29(38)45-22-25(23-46-30(39)32-13-17-43-21-19-41-2)44-16-4-7-24(34)6-3-12-31-26(35)11-14-33-27(36)9-10-28(33)37/h9-10,25H,3-8,11-23H2,1-2H3,(H,31,35)(H,32,39) |
| InChIKey | ZTPSZIYHRKZPFW-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 194.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|