C21H28N4O8 — CID 170280660
3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propyl]propanamide (PubChem CID 170280660) has the molecular formula C21H28N4O8 and a molecular weight of 464.48 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propyl]propanamide |
|---|---|
| PubChem CID | 170280660 |
| Molecular Formula | C21H28N4O8 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[3-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]propyl]propanamide |
| SMILES | O=C(CCN1C(=O)C=CC1=O)NCCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H28N4O8/c26-16(6-10-24-18(28)2-3-19(24)29)22-8-1-12-32-14-15-33-13-9-23-17(27)7-11-25-20(30)4-5-21(25)31/h2-5H,1,6-15H2,(H,22,26)(H,23,27) |
| InChIKey | SSQFLFGBQRNFAY-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|