C21H38N2O8 — CID 162430872
3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;ethane;molecular hydrogen (PubChem CID 162430872) has the molecular formula C21H38N2O8 and a molecular weight of 446.54 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;ethane;molecular hydrogen.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 162430872 |
| Molecular Formula | C21H38N2O8 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-N-[2-[2-[2-[2-(3-oxobutoxy)ethoxy]ethoxy]ethoxy]ethyl]propanamide;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O.[H][H] |
| InChI | InChI=1S/C19H30N2O8.C2H6.H2/c1-16(22)5-8-26-10-12-28-14-15-29-13-11-27-9-6-20-17(23)4-7-21-18(24)2-3-19(21)25;1-2;/h2-3H,4-15H2,1H3,(H,20,23);1-2H3;1H |
| InChIKey | MUIFOOFEXOMEEY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|