C22H35N3O11 — CID 177144723
3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;molecular hydrogen;pyrrolidine-2,5-dione (PubChem CID 177144723) has the molecular formula C22H35N3O11 and a molecular weight of 517.53 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;molecular hydrogen;pyrrolidine-2,5-dione.
| Compound Name | 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;molecular hydrogen;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177144723 |
| Molecular Formula | C22H35N3O11 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;molecular hydrogen;pyrrolidine-2,5-dione |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)CCN1C(=O)C=CC1=O.O=C1CCC(=O)N1.[H][H] |
| InChI | InChI=1S/C18H28N2O9.C4H5NO2.H2/c21-15(3-6-20-16(22)1-2-17(20)23)19-5-8-27-10-12-29-14-13-28-11-9-26-7-4-18(24)25;6-3-1-2-4(7)5-3;/h1-2H,3-14H2,(H,19,21)(H,24,25);1-2H2,(H,5,6,7);1H |
| InChIKey | WHIYEWIICFFKDH-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 186.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|