C18H28N2O7 — CID 168749936
3-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]propoxy]propanoic acid (PubChem CID 168749936) has the molecular formula C18H28N2O7 and a molecular weight of 384.43 g/mol. Its IUPAC name is 3-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]propoxy]propanoic acid.
| Compound Name | 3-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]propoxy]propanoic acid |
|---|---|
| PubChem CID | 168749936 |
| Molecular Formula | C18H28N2O7 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 3-[3-[2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]ethoxy]propoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCOCCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C18H28N2O7/c21-15(5-2-1-3-10-20-16(22)6-7-17(20)23)19-9-14-27-12-4-11-26-13-8-18(24)25/h6-7H,1-5,8-14H2,(H,19,21)(H,24,25) |
| InChIKey | WIZFTUPZPNTIBU-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|