C30H38N2O11 — CID 164994487
3-[4-[3-[4-(2-carboxyethoxy)butanoyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]-4-oxobutoxy]propanoic acid (PubChem CID 164994487) has the molecular formula C30H38N2O11 and a molecular weight of 602.64 g/mol. Its IUPAC name is 3-[4-[3-[4-(2-carboxyethoxy)butanoyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]-4-oxobutoxy]propanoic acid.
| Compound Name | 3-[4-[3-[4-(2-carboxyethoxy)butanoyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]-4-oxobutoxy]propanoic acid |
|---|---|
| PubChem CID | 164994487 |
| Molecular Formula | C30H38N2O11 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 3-[4-[3-[4-(2-carboxyethoxy)butanoyl]-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]phenyl]-4-oxobutoxy]propanoic acid |
| SMILES | O=C(O)CCOCCCC(=O)c1cc(NC(=O)CCCCCN2C(=O)C=CC2=O)cc(C(=O)CCCOCCC(=O)O)c1 |
| InChI | InChI=1S/C30H38N2O11/c33-24(6-4-14-42-16-11-29(38)39)21-18-22(25(34)7-5-15-43-17-12-30(40)41)20-23(19-21)31-26(35)8-2-1-3-13-32-27(36)9-10-28(32)37/h9-10,18-20H,1-8,11-17H2,(H,31,35)(H,38,39)(H,40,41) |
| InChIKey | WIOUGFLECWTMQY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 193.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|