C17H27NO4 — CID 71336496
13-(2,5-dioxopyrrol-1-yl)tridecanoic acid (PubChem CID 71336496) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is 13-(2,5-dioxopyrrol-1-yl)tridecanoic acid.
| Compound Name | 13-(2,5-dioxopyrrol-1-yl)tridecanoic acid |
|---|---|
| PubChem CID | 71336496 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 13-(2,5-dioxopyrrol-1-yl)tridecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C17H27NO4/c19-15-12-13-16(20)18(15)14-10-8-6-4-2-1-3-5-7-9-11-17(21)22/h12-13H,1-11,14H2,(H,21,22) |
| InChIKey | HZCBTRFPBNHGBS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|