C26H43NO11 — CID 162034103
3-[2-[2-[2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 162034103) has the molecular formula C26H43NO11 and a molecular weight of 545.63 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 162034103 |
| Molecular Formula | C26H43NO11 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[9-(2,5-dioxopyrrol-1-yl)-4-oxononoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCCC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C26H43NO11/c28-23(5-2-1-3-10-27-24(29)7-8-25(27)30)6-4-11-33-13-15-35-17-19-37-21-22-38-20-18-36-16-14-34-12-9-26(31)32/h7-8H,1-6,9-22H2,(H,31,32) |
| InChIKey | GPFIZKCPVHKOOC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|