C28H36N2O9S2 — CID 158165521
S-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl] 5-[5-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]sulfanyl-5-oxopentoxy]pentanethioate (PubChem CID 158165521) has the molecular formula C28H36N2O9S2 and a molecular weight of 608.74 g/mol. Its IUPAC name is S-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl] 5-[5-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]sulfanyl-5-oxopentoxy]pentanethioate.
| Compound Name | S-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl] 5-[5-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]sulfanyl-5-oxopentoxy]pentanethioate |
|---|---|
| PubChem CID | 158165521 |
| Molecular Formula | C28H36N2O9S2 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | S-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl] 5-[5-[5-(2,5-dioxopyrrol-1-yl)-2-oxopentyl]sulfanyl-5-oxopentoxy]pentanethioate |
| SMILES | O=C(CCCN1C(=O)C=CC1=O)CSC(=O)CCCCOCCCCC(=O)SCC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C28H36N2O9S2/c31-21(7-5-15-29-23(33)11-12-24(29)34)19-40-27(37)9-1-3-17-39-18-4-2-10-28(38)41-20-22(32)8-6-16-30-25(35)13-14-26(30)36/h11-14H,1-10,15-20H2 |
| InChIKey | FWUGWXUHJLPXIW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 152.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|