C14H22N2O3 — CID 134211555
10-(2,5-dioxopyrrol-1-yl)decanamide (PubChem CID 134211555) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 10-(2,5-dioxopyrrol-1-yl)decanamide.
| Compound Name | 10-(2,5-dioxopyrrol-1-yl)decanamide |
|---|---|
| PubChem CID | 134211555 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 10-(2,5-dioxopyrrol-1-yl)decanamide |
| SMILES | NC(=O)CCCCCCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H22N2O3/c15-12(17)8-6-4-2-1-3-5-7-11-16-13(18)9-10-14(16)19/h9-10H,1-8,11H2,(H2,15,17) |
| InChIKey | MJHRPMPOEHRSPF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|