C9H14ClN3O3 — CID 91667264
5-(2,5-dioxopyrrol-1-yl)pentanehydrazide;hydrochloride (PubChem CID 91667264) has the molecular formula C9H14ClN3O3 and a molecular weight of 247.68 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide;hydrochloride.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide;hydrochloride |
|---|---|
| PubChem CID | 91667264 |
| Molecular Formula | C9H14ClN3O3 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)pentanehydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H13N3O3.ClH/c10-11-7(13)3-1-2-6-12-8(14)4-5-9(12)15;/h4-5H,1-3,6,10H2,(H,11,13);1H |
| InChIKey | LONHVDZWNFFXCQ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|