C15H28N2O3 — CID 145076729
5-(2,5-dioxopyrrol-1-yl)-N-ethylpentanamide;ethane (PubChem CID 145076729) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 5-(2,5-dioxopyrrol-1-yl)-N-ethylpentanamide;ethane.
| Compound Name | 5-(2,5-dioxopyrrol-1-yl)-N-ethylpentanamide;ethane |
|---|---|
| PubChem CID | 145076729 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)-N-ethylpentanamide;ethane |
| SMILES | CC.CC.CCNC(=O)CCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C11H16N2O3.2C2H6/c1-2-12-9(14)5-3-4-8-13-10(15)6-7-11(13)16;2*1-2/h6-7H,2-5,8H2,1H3,(H,12,14);2*1-2H3 |
| InChIKey | DJKTZXBSBBBSIE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|