C13H20N2O3 — CID 121327484
4-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)butanamide (PubChem CID 121327484) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)butanamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)butanamide |
|---|---|
| PubChem CID | 121327484 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-(3-methylbutyl)butanamide |
| SMILES | CC(C)CCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H20N2O3/c1-10(2)7-8-14-11(16)4-3-9-15-12(17)5-6-13(15)18/h5-6,10H,3-4,7-9H2,1-2H3,(H,14,16) |
| InChIKey | IRBAIWJCYNBSJT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|